About 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine
6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine (PubChem CID 142537454) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine.
Molecular Properties
| Compound Name | 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine |
| PubChem CID | 142537454 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine |
| SMILES | C=CC1(C)OC(C(N)C(F)F)CCC1N |
| InChI | InChI=1S/C10H18F2N2O/c1-3-10(2)7(13)5-4-6(15-10)8(14)9(11)12/h3,6-9H,1,4-5,13-14H2,2H3 |
| InChIKey | RFTBHQZFTXTTOX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine?
The IUPAC name of 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine (CID 142537454) is 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine.
What is the SMILES notation for 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine?
The canonical SMILES for 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine is C=CC1(C)OC(C(N)C(F)F)CCC1N.
What is the InChIKey of 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine?
The InChIKey is RFTBHQZFTXTTOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O/c1-3-10(2)7(13)5-4-6(15-10)8(14)9(11)12/h3,6-9H,1,4-5,13-14H2,2H3.
What are the key properties of 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine?
6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine has a molecular weight of 220.26 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-amino-2,2-difluoroethyl)-2-ethenyl-2-methyloxan-3-amine is sourced from PubChem (CID 142537454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).