About N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane
N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane (PubChem CID 142537543) has the molecular formula C13H29NOS
and a molecular weight of 247.45 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane.
Molecular Properties
| Compound Name | N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane |
| PubChem CID | 142537543 |
| Molecular Formula | C13H29NOS |
| Molecular Weight | 247.45 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane |
| SMILES | C.CC(C)C.CCC(NS)C1CCC=CO1 |
| InChI | InChI=1S/C8H15NOS.C4H10.CH4/c1-2-7(9-11)8-5-3-4-6-10-8;1-4(2)3;/h4,6-9,11H,2-3,5H2,1H3;4H,1-3H3;1H4 |
| InChIKey | JJSXJSVOQMYEER-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane?
The IUPAC name of N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane (CID 142537543) is N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane.
What is the SMILES notation for N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane?
The canonical SMILES for N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane is C.CC(C)C.CCC(NS)C1CCC=CO1.
What is the InChIKey of N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane?
The InChIKey is JJSXJSVOQMYEER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NOS.C4H10.CH4/c1-2-7(9-11)8-5-3-4-6-10-8;1-4(2)3;/h4,6-9,11H,2-3,5H2,1H3;4H,1-3H3;1H4.
What are the key properties of N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane?
N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane has a molecular weight of 247.45 g/mol, XLogP of 4.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-dihydro-2H-pyran-2-yl)propyl]thiohydroxylamine;methane;2-methylpropane is sourced from PubChem (CID 142537543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).