C20H21FN6O2S — CID 142537584
(2R,3R,4R,5R,6S)-5-azido-2-(azidomethyl)-4-fluoro-6-(4-methylphenyl)sulfanyl-3-phenylmethoxyoxane (PubChem CID 142537584) has the molecular formula C20H21FN6O2S and a molecular weight of 428.49 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-azido-2-(azidomethyl)-4-fluoro-6-(4-methylphenyl)sulfanyl-3-phenylmethoxyoxane.
| Compound Name | (2R,3R,4R,5R,6S)-5-azido-2-(azidomethyl)-4-fluoro-6-(4-methylphenyl)sulfanyl-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 142537584 |
| Molecular Formula | C20H21FN6O2S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-azido-2-(azidomethyl)-4-fluoro-6-(4-methylphenyl)sulfanyl-3-phenylmethoxyoxane |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](CN=[N+]=[N-])[C@@H](OCc3ccccc3)[C@H](F)[C@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C20H21FN6O2S/c1-13-7-9-15(10-8-13)30-20-18(25-27-23)17(21)19(16(29-20)11-24-26-22)28-12-14-5-3-2-4-6-14/h2-10,16-20H,11-12H2,1H3/t16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | ALBIOENGSJEARH-WAPOTWQKSA-N |
| XLogP | 5.72 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|