C11H8F5N5O — CID 14253821
2,2,3,3,3-pentafluoro-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]propanamide (PubChem CID 14253821) has the molecular formula C11H8F5N5O and a molecular weight of 321.21 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 14253821 |
| Molecular Formula | C11H8F5N5O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]propanamide |
| SMILES | O=C(Nc1ccc(Cc2nn[nH]n2)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8F5N5O/c12-10(13,11(14,15)16)9(22)17-7-3-1-6(2-4-7)5-8-18-20-21-19-8/h1-4H,5H2,(H,17,22)(H,18,19,20,21) |
| InChIKey | OAYSLYRXTSDVAZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|