C30H46O5 — CID 142538727
[5-[(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)oxy]-5-oxopentyl] 2-methylpentanoate (PubChem CID 142538727) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is [5-[(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)oxy]-5-oxopentyl] 2-methylpentanoate.
| Compound Name | [5-[(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)oxy]-5-oxopentyl] 2-methylpentanoate |
|---|---|
| PubChem CID | 142538727 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | [5-[(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)oxy]-5-oxopentyl] 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)OCCCCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C30H46O5/c1-5-8-20(2)28(33)34-18-7-6-9-27(32)35-26-13-12-24-23-11-10-21-19-22(31)14-16-29(21,3)25(23)15-17-30(24,26)4/h19-20,23-26H,5-18H2,1-4H3 |
| InChIKey | ZWIRKTTYLICMBB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|