About 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde
4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde (PubChem CID 142538840) has the molecular formula C18H24N2O2S2
and a molecular weight of 364.54 g/mol. Its IUPAC name is 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde |
| PubChem CID | 142538840 |
| Molecular Formula | C18H24N2O2S2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde |
| SMILES | CNc1nc(C(C)(C)C)cs1.O=Cc1ccc(C#CCCCO)s1 |
| InChI | InChI=1S/C10H10O2S.C8H14N2S/c11-7-3-1-2-4-9-5-6-10(8-12)13-9;1-8(2,3)6-5-11-7(9-4)10-6/h5-6,8,11H,1,3,7H2;5H,1-4H3,(H,9,10) |
| InChIKey | DYTYPTBDICDNIY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde?
The IUPAC name of 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde (CID 142538840) is 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde.
What is the SMILES notation for 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde?
The canonical SMILES for 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde is CNc1nc(C(C)(C)C)cs1.O=Cc1ccc(C#CCCCO)s1.
What is the InChIKey of 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde?
The InChIKey is DYTYPTBDICDNIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2S.C8H14N2S/c11-7-3-1-2-4-9-5-6-10(8-12)13-9;1-8(2,3)6-5-11-7(9-4)10-6/h5-6,8,11H,1,3,7H2;5H,1-4H3,(H,9,10).
What are the key properties of 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde?
4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde has a molecular weight of 364.54 g/mol, XLogP of 4.17, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-methyl-1,3-thiazol-2-amine;5-(5-hydroxypent-1-ynyl)thiophene-2-carbaldehyde is sourced from PubChem (CID 142538840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).