C17H19N5OS — CID 142540064
azetidin-1-yl-[2-[[(3Z)-3-(methylideneamino)hexa-3,5-dien-2-yl]amino]thieno[3,2-d]pyrimidin-4-yl]methanone (PubChem CID 142540064) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is azetidin-1-yl-[2-[[(3Z)-3-(methylideneamino)hexa-3,5-dien-2-yl]amino]thieno[3,2-d]pyrimidin-4-yl]methanone.
| Compound Name | azetidin-1-yl-[2-[[(3Z)-3-(methylideneamino)hexa-3,5-dien-2-yl]amino]thieno[3,2-d]pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 142540064 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | azetidin-1-yl-[2-[[(3Z)-3-(methylideneamino)hexa-3,5-dien-2-yl]amino]thieno[3,2-d]pyrimidin-4-yl]methanone |
| SMILES | C=C/C=C(\N=C)C(C)Nc1nc(C(=O)N2CCC2)c2sccc2n1 |
| InChI | InChI=1S/C17H19N5OS/c1-4-6-12(18-3)11(2)19-17-20-13-7-10-24-15(13)14(21-17)16(23)22-8-5-9-22/h4,6-7,10-11H,1,3,5,8-9H2,2H3,(H,19,20,21)/b12-6- |
| InChIKey | DJVOLTSZTVNTPH-SDQBBNPISA-N |
| XLogP | 3.11 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|