About 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane
1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane (PubChem CID 142540149) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane |
| PubChem CID | 142540149 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane |
| SMILES | CC.CC(C)c1ccc(C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C15H18.C2H6/c1-12(2)13-8-10-15(11-9-13)14-6-4-3-5-7-14;1-2/h4,6-12H,3,5H2,1-2H3;1-2H3 |
| InChIKey | ZTYZTCOCHZDYEH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane (CID 142540149) is 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane is CC.CC(C)c1ccc(C2=CCCC=C2)cc1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane?
The InChIKey is ZTYZTCOCHZDYEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18.C2H6/c1-12(2)13-8-10-15(11-9-13)14-6-4-3-5-7-14;1-2/h4,6-12H,3,5H2,1-2H3;1-2H3.
What are the key properties of 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane?
1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane has a molecular weight of 228.38 g/mol, XLogP of 5.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yl-4-propan-2-ylbenzene;ethane is sourced from PubChem (CID 142540149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).