C11H18BN3O3 — CID 142540652
[2-[(2R)-2-propan-2-ylmorpholin-4-yl]pyrimidin-5-yl]boronic acid (PubChem CID 142540652) has the molecular formula C11H18BN3O3 and a molecular weight of 251.09 g/mol. Its IUPAC name is [2-[(2R)-2-propan-2-ylmorpholin-4-yl]pyrimidin-5-yl]boronic acid.
| Compound Name | [2-[(2R)-2-propan-2-ylmorpholin-4-yl]pyrimidin-5-yl]boronic acid |
|---|---|
| PubChem CID | 142540652 |
| Molecular Formula | C11H18BN3O3 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | [2-[(2R)-2-propan-2-ylmorpholin-4-yl]pyrimidin-5-yl]boronic acid |
| SMILES | CC(C)[C@@H]1CN(c2ncc(B(O)O)cn2)CCO1 |
| InChI | InChI=1S/C11H18BN3O3/c1-8(2)10-7-15(3-4-18-10)11-13-5-9(6-14-11)12(16)17/h5-6,8,10,16-17H,3-4,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | ZKIZIEVFLRIKPO-JTQLQIEISA-N |
| XLogP | -0.98 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|