C54H43NO — CID 142540810
N-(4-dibenzofuran-4-ylphenyl)-N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-amine (PubChem CID 142540810) has the molecular formula C54H43NO and a molecular weight of 721.94 g/mol. Its IUPAC name is N-(4-dibenzofuran-4-ylphenyl)-N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-amine.
| Compound Name | N-(4-dibenzofuran-4-ylphenyl)-N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-amine |
|---|---|
| PubChem CID | 142540810 |
| Molecular Formula | C54H43NO |
| Molecular Weight | 721.94 g/mol |
| Exact Mass | 721.33 |
| IUPAC Name | N-(4-dibenzofuran-4-ylphenyl)-N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-amine |
| SMILES | C=C/C=C(\C=C)c1ccc(N(c2ccc(-c3cccc4c3oc3ccccc34)cc2)c2ccc3c(c2)-c2cc4c(cc2C3(C)C)-c2ccccc2C4(C)C)cc1 |
| InChI | InChI=1S/C54H43NO/c1-7-14-34(8-2)35-21-25-37(26-22-35)55(38-27-23-36(24-28-38)40-17-13-18-43-42-16-10-12-20-51(42)56-52(40)43)39-29-30-48-44(31-39)46-33-49-45(32-50(46)54(48,5)6)41-15-9-11-19-47(41)53(49,3)4/h7-33H,1-2H2,3-6H3/b34-14+ |
| InChIKey | JDDOHQVRUNUHIU-HBHSWBPBSA-N |
| XLogP | 15.09 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.94 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|