C22H15Cl2FO3 — CID 142540900
fluoro 2,5-bis(2-chlorophenyl)-4-propanoylbenzoate (PubChem CID 142540900) has the molecular formula C22H15Cl2FO3 and a molecular weight of 417.26 g/mol. Its IUPAC name is fluoro 2,5-bis(2-chlorophenyl)-4-propanoylbenzoate.
| Compound Name | fluoro 2,5-bis(2-chlorophenyl)-4-propanoylbenzoate |
|---|---|
| PubChem CID | 142540900 |
| Molecular Formula | C22H15Cl2FO3 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | fluoro 2,5-bis(2-chlorophenyl)-4-propanoylbenzoate |
| SMILES | CCC(=O)c1cc(-c2ccccc2Cl)c(C(=O)OF)cc1-c1ccccc1Cl |
| InChI | InChI=1S/C22H15Cl2FO3/c1-2-21(26)17-11-16(14-8-4-6-10-20(14)24)18(22(27)28-25)12-15(17)13-7-3-5-9-19(13)23/h3-12H,2H2,1H3 |
| InChIKey | ODFFVHXQAZKQIB-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |