C62H53N — CID 142540910
N-[3-cyclohexa-1,5-dien-1-yl-1-ethenyl-3-phenyl-2-[(Z)-prop-1-enyl]inden-5-yl]-6,6,12,12-tetramethyl-N-(4-phenylphenyl)indeno[1,2-b]fluoren-3-amine (PubChem CID 142540910) has the molecular formula C62H53N and a molecular weight of 812.11 g/mol. Its IUPAC name is N-[3-cyclohexa-1,5-dien-1-yl-1-ethenyl-3-phenyl-2-[(Z)-prop-1-enyl]inden-5-yl]-6,6,12,12-tetramethyl-N-(4-phenylphenyl)indeno[1,2-b]fluoren-3-amine.
| Compound Name | N-[3-cyclohexa-1,5-dien-1-yl-1-ethenyl-3-phenyl-2-[(Z)-prop-1-enyl]inden-5-yl]-6,6,12,12-tetramethyl-N-(4-phenylphenyl)indeno[1,2-b]fluoren-3-amine |
|---|---|
| PubChem CID | 142540910 |
| Molecular Formula | C62H53N |
| Molecular Weight | 812.11 g/mol |
| Exact Mass | 811.42 |
| IUPAC Name | N-[3-cyclohexa-1,5-dien-1-yl-1-ethenyl-3-phenyl-2-[(Z)-prop-1-enyl]inden-5-yl]-6,6,12,12-tetramethyl-N-(4-phenylphenyl)indeno[1,2-b]fluoren-3-amine |
| SMILES | C=CC1=C(/C=C\C)C(C2=CCCC=C2)(c2ccccc2)c2cc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)-c3cc5c(cc3C4(C)C)-c3ccccc3C5(C)C)ccc21 |
| InChI | InChI=1S/C62H53N/c1-7-20-56-48(8-2)50-35-33-47(38-59(50)62(56,43-23-14-10-15-24-43)44-25-16-11-17-26-44)63(45-31-29-42(30-32-45)41-21-12-9-13-22-41)46-34-36-55-51(37-46)53-40-57-52(39-58(53)61(55,5)6)49-27-18-19-28-54(49)60(57,3)4/h7-10,12-16,18-40H,2,11,17H2,1,3-6H3/b20-7- |
| InChIKey | MMSYXIHXIDAUOQ-SCDVKCJHSA-N |
| XLogP | 16.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.11 |
| LogP ≤ 5 | 16.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |