C24H20Cl2O3 — CID 142540959
ethyl 2-(2,4-dichlorophenyl)-5-phenyl-4-propanoylbenzoate (PubChem CID 142540959) has the molecular formula C24H20Cl2O3 and a molecular weight of 427.33 g/mol. Its IUPAC name is ethyl 2-(2,4-dichlorophenyl)-5-phenyl-4-propanoylbenzoate.
| Compound Name | ethyl 2-(2,4-dichlorophenyl)-5-phenyl-4-propanoylbenzoate |
|---|---|
| PubChem CID | 142540959 |
| Molecular Formula | C24H20Cl2O3 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | ethyl 2-(2,4-dichlorophenyl)-5-phenyl-4-propanoylbenzoate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)c(C(=O)CC)cc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H20Cl2O3/c1-3-23(27)20-14-19(17-11-10-16(25)12-22(17)26)21(24(28)29-4-2)13-18(20)15-8-6-5-7-9-15/h5-14H,3-4H2,1-2H3 |
| InChIKey | XNBRMUQWBMLWBX-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |