C63H52INO — CID 142540979
N-(4-dibenzofuran-4-ylphenyl)-4-[4-[2-[(dimethyl-λ3-iodanyl)methyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-4-yl]phenyl]-N-phenylaniline (PubChem CID 142540979) has the molecular formula C63H52INO and a molecular weight of 966.02 g/mol. Its IUPAC name is N-(4-dibenzofuran-4-ylphenyl)-4-[4-[2-[(dimethyl-λ3-iodanyl)methyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-4-yl]phenyl]-N-phenylaniline.
| Compound Name | N-(4-dibenzofuran-4-ylphenyl)-4-[4-[2-[(dimethyl-λ3-iodanyl)methyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-4-yl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 142540979 |
| Molecular Formula | C63H52INO |
| Molecular Weight | 966.02 g/mol |
| Exact Mass | 965.31 |
| IUPAC Name | N-(4-dibenzofuran-4-ylphenyl)-4-[4-[2-[(dimethyl-λ3-iodanyl)methyl]-6,6,12,12-tetramethylindeno[1,2-b]fluoren-4-yl]phenyl]-N-phenylaniline |
| SMILES | CI(C)Cc1cc(-c2ccc(-c3ccc(N(c4ccccc4)c4ccc(-c5cccc6c5oc5ccccc56)cc4)cc3)cc2)c2c(c1)C(C)(C)c1cc3c(cc1-2)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C63H52INO/c1-62(2)55-21-12-10-17-49(55)53-37-57-54(38-56(53)62)60-52(35-40(39-64(5)6)36-58(60)63(57,3)4)44-25-23-41(24-26-44)42-27-31-46(32-28-42)65(45-15-8-7-9-16-45)47-33-29-43(30-34-47)48-19-14-20-51-50-18-11-13-22-59(50)66-61(48)51/h7-38H,39H2,1-6H3 |
| InChIKey | PPUJQHBXTVLYDM-UHFFFAOYSA-N |
| XLogP | 17.94 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.02 |
| LogP ≤ 5 | 17.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|