C67H53NO — CID 142541032
N-(4-dibenzofuran-3-ylphenyl)-N-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]-6,6,12,12-tetramethyl-7,10-diphenylindeno[1,2-b]fluoren-2-amine (PubChem CID 142541032) has the molecular formula C67H53NO and a molecular weight of 888.17 g/mol. Its IUPAC name is N-(4-dibenzofuran-3-ylphenyl)-N-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]-6,6,12,12-tetramethyl-7,10-diphenylindeno[1,2-b]fluoren-2-amine.
| Compound Name | N-(4-dibenzofuran-3-ylphenyl)-N-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]-6,6,12,12-tetramethyl-7,10-diphenylindeno[1,2-b]fluoren-2-amine |
|---|---|
| PubChem CID | 142541032 |
| Molecular Formula | C67H53NO |
| Molecular Weight | 888.17 g/mol |
| Exact Mass | 887.41 |
| IUPAC Name | N-(4-dibenzofuran-3-ylphenyl)-N-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]-6,6,12,12-tetramethyl-7,10-diphenylindeno[1,2-b]fluoren-2-amine |
| SMILES | C=C(/C=C\C=C/C)c1ccc(N(c2ccc(-c3ccc4c(c3)oc3ccccc34)cc2)c2ccc3c(c2)C(C)(C)c2cc4c(cc2-3)C(C)(C)c2c(-c3ccccc3)ccc(-c3ccccc3)c2-4)cc1 |
| InChI | InChI=1S/C67H53NO/c1-7-8-11-18-43(2)44-25-30-49(31-26-44)68(50-32-27-45(28-33-50)48-29-35-56-55-23-16-17-24-62(55)69-63(56)39-48)51-34-36-54-57-41-61-58(42-60(57)66(3,4)59(54)40-51)64-52(46-19-12-9-13-20-46)37-38-53(65(64)67(61,5)6)47-21-14-10-15-22-47/h7-42H,2H2,1,3-6H3/b8-7-,18-11- |
| InChIKey | TYGZCYJWIKGWFR-FKCKPFQOSA-N |
| XLogP | 18.81 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.17 |
| LogP ≤ 5 | 18.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|