C71H71NO — CID 142541181
N-(4-dibenzofuran-4-yl-4-methylcyclohexa-1,5-dien-1-yl)-10-phenyl-N-(4-phenylphenyl)-6,6,12,12-tetra(propan-2-yl)indeno[1,2-b]fluoren-2-amine;ethane (PubChem CID 142541181) has the molecular formula C71H71NO and a molecular weight of 954.35 g/mol. Its IUPAC name is N-(4-dibenzofuran-4-yl-4-methylcyclohexa-1,5-dien-1-yl)-10-phenyl-N-(4-phenylphenyl)-6,6,12,12-tetra(propan-2-yl)indeno[1,2-b]fluoren-2-amine;ethane.
| Compound Name | N-(4-dibenzofuran-4-yl-4-methylcyclohexa-1,5-dien-1-yl)-10-phenyl-N-(4-phenylphenyl)-6,6,12,12-tetra(propan-2-yl)indeno[1,2-b]fluoren-2-amine;ethane |
|---|---|
| PubChem CID | 142541181 |
| Molecular Formula | C71H71NO |
| Molecular Weight | 954.35 g/mol |
| Exact Mass | 953.55 |
| IUPAC Name | N-(4-dibenzofuran-4-yl-4-methylcyclohexa-1,5-dien-1-yl)-10-phenyl-N-(4-phenylphenyl)-6,6,12,12-tetra(propan-2-yl)indeno[1,2-b]fluoren-2-amine;ethane |
| SMILES | CC.CC(C)C1(C(C)C)c2cc(N(C3=CCC(C)(c4cccc5c4oc4ccccc45)C=C3)c3ccc(-c4ccccc4)cc3)ccc2-c2cc3c(cc21)-c1c(-c2ccccc2)cccc1C3(C(C)C)C(C)C |
| InChI | InChI=1S/C69H65NO.C2H6/c1-43(2)68(44(3)4)59-27-18-25-53(49-22-14-11-15-23-49)65(59)58-42-62-57(41-63(58)68)54-35-34-52(40-61(54)69(62,45(5)6)46(7)8)70(50-32-30-48(31-33-50)47-20-12-10-13-21-47)51-36-38-67(9,39-37-51)60-28-19-26-56-55-24-16-17-29-64(55)71-66(56)60;1-2/h10-38,40-46H,39H2,1-9H3;1-2H3 |
| InChIKey | KEXLAAXBWWQRQX-UHFFFAOYSA-N |
| XLogP | 20.04 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.35 |
| LogP ≤ 5 | 20.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |