C57H49N — CID 142541184
N-(4-cyclohexa-1,5-dien-1-ylphenyl)-N-(9,9-dimethylfluoren-2-yl)-6,6,12,12-tetramethyl-10-phenylindeno[1,2-b]fluoren-2-amine (PubChem CID 142541184) has the molecular formula C57H49N and a molecular weight of 748.03 g/mol. Its IUPAC name is N-(4-cyclohexa-1,5-dien-1-ylphenyl)-N-(9,9-dimethylfluoren-2-yl)-6,6,12,12-tetramethyl-10-phenylindeno[1,2-b]fluoren-2-amine.
| Compound Name | N-(4-cyclohexa-1,5-dien-1-ylphenyl)-N-(9,9-dimethylfluoren-2-yl)-6,6,12,12-tetramethyl-10-phenylindeno[1,2-b]fluoren-2-amine |
|---|---|
| PubChem CID | 142541184 |
| Molecular Formula | C57H49N |
| Molecular Weight | 748.03 g/mol |
| Exact Mass | 747.39 |
| IUPAC Name | N-(4-cyclohexa-1,5-dien-1-ylphenyl)-N-(9,9-dimethylfluoren-2-yl)-6,6,12,12-tetramethyl-10-phenylindeno[1,2-b]fluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(C4=CCCC=C4)cc3)c3ccc4c(c3)C(C)(C)c3cc5c(cc3-4)C(C)(C)c3cccc(-c4ccccc4)c3-5)cc21 |
| InChI | InChI=1S/C57H49N/c1-55(2)48-22-14-13-20-43(48)44-30-28-40(32-50(44)55)58(39-26-24-37(25-27-39)36-16-9-7-10-17-36)41-29-31-45-46-34-53-47(35-52(46)57(5,6)51(45)33-41)54-42(38-18-11-8-12-19-38)21-15-23-49(54)56(53,3)4/h8-9,11-35H,7,10H2,1-6H3 |
| InChIKey | WYSKCBOZIPWZTP-UHFFFAOYSA-N |
| XLogP | 15.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.03 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |