C36H56N4O2 — CID 142541292
11,23-ditert-butyl-4,4,6,6,15,19-hexamethyl-3,7,15,19-tetrazatricyclo[19.3.1.19,13]hexacosa-1(24),2,7,9,11,13(26),21(25),22-octaene-25,26-diol (PubChem CID 142541292) has the molecular formula C36H56N4O2 and a molecular weight of 576.87 g/mol. Its IUPAC name is 11,23-ditert-butyl-4,4,6,6,15,19-hexamethyl-3,7,15,19-tetrazatricyclo[19.3.1.19,13]hexacosa-1(24),2,7,9,11,13(26),21(25),22-octaene-25,26-diol.
| Compound Name | 11,23-ditert-butyl-4,4,6,6,15,19-hexamethyl-3,7,15,19-tetrazatricyclo[19.3.1.19,13]hexacosa-1(24),2,7,9,11,13(26),21(25),22-octaene-25,26-diol |
|---|---|
| PubChem CID | 142541292 |
| Molecular Formula | C36H56N4O2 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | 11,23-ditert-butyl-4,4,6,6,15,19-hexamethyl-3,7,15,19-tetrazatricyclo[19.3.1.19,13]hexacosa-1(24),2,7,9,11,13(26),21(25),22-octaene-25,26-diol |
| SMILES | CN1CCCN(C)Cc2cc(C(C)(C)C)cc(c2O)/C=N/C(C)(C)CC(C)(C)/N=C\c2cc(C(C)(C)C)cc(c2O)C1 |
| InChI | InChI=1S/C36H56N4O2/c1-33(2,3)29-16-25-20-37-35(7,8)24-36(9,10)38-21-26-17-30(34(4,5)6)19-28(32(26)42)23-40(12)15-13-14-39(11)22-27(18-29)31(25)41/h16-21,41-42H,13-15,22-24H2,1-12H3/b37-20-,38-21+ |
| InChIKey | NFGHCTODXDZPLC-LCDUDMKWSA-N |
| XLogP | 7.45 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|