About N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine
N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 142541444) has the molecular formula C13H19BrFN3O4
and a molecular weight of 380.21 g/mol. Its IUPAC name is N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| PubChem CID | 142541444 |
| Molecular Formula | C13H19BrFN3O4 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCN(C)CCNc1c(OC)cc(Br)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19BrFN3O4/c1-17(6-7-21-2)5-4-16-12-10(22-3)8-9(14)11(15)13(12)18(19)20/h8,16H,4-7H2,1-3H3 |
| InChIKey | YRMSOMUUNCFOMN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine?
The IUPAC name of N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine (CID 142541444) is N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine is COCCN(C)CCNc1c(OC)cc(Br)c(F)c1[N+](=O)[O-].
What is the InChIKey of N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine?
The InChIKey is YRMSOMUUNCFOMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrFN3O4/c1-17(6-7-21-2)5-4-16-12-10(22-3)8-9(14)11(15)13(12)18(19)20/h8,16H,4-7H2,1-3H3.
What are the key properties of N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine?
N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine has a molecular weight of 380.21 g/mol, XLogP of 2.50, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-3-fluoro-6-methoxy-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 142541444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).