C12H12ClN3O3 — CID 142541469
3-chloro-N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-2-nitroaniline (PubChem CID 142541469) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is 3-chloro-N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-2-nitroaniline.
| Compound Name | 3-chloro-N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 142541469 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3-chloro-N-[(2-ethyl-1,3-oxazol-4-yl)methyl]-2-nitroaniline |
| SMILES | CCc1nc(CNc2cccc(Cl)c2[N+](=O)[O-])co1 |
| InChI | InChI=1S/C12H12ClN3O3/c1-2-11-15-8(7-19-11)6-14-10-5-3-4-9(13)12(10)16(17)18/h3-5,7,14H,2,6H2,1H3 |
| InChIKey | FFASLXMLRMBKQO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|