C22H28N4O — CID 142541542
2-[6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-3-pyridinyl]-1-(2-ethoxyethyl)benzimidazole (PubChem CID 142541542) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-3-pyridinyl]-1-(2-ethoxyethyl)benzimidazole.
| Compound Name | 2-[6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-3-pyridinyl]-1-(2-ethoxyethyl)benzimidazole |
|---|---|
| PubChem CID | 142541542 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-[6-[(2S,5R)-2,5-dimethylpyrrolidin-1-yl]-3-pyridinyl]-1-(2-ethoxyethyl)benzimidazole |
| SMILES | CCOCCn1c(-c2ccc(N3[C@H](C)CC[C@@H]3C)nc2)nc2ccccc21 |
| InChI | InChI=1S/C22H28N4O/c1-4-27-14-13-25-20-8-6-5-7-19(20)24-22(25)18-11-12-21(23-15-18)26-16(2)9-10-17(26)3/h5-8,11-12,15-17H,4,9-10,13-14H2,1-3H3/t16-,17+ |
| InChIKey | YIYMKCDQWOKJOM-CALCHBBNSA-N |
| XLogP | 4.51 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|