C32H49N3O4 — CID 142541592
tert-butyl (2R)-2-[[[(3Z,5Z)-4-methoxy-2-methylhepta-1,3,5-trien-3-yl]-[(4Z)-3-methylidene-6-(2-methylpyrrolidin-1-yl)hepta-1,4,6-trien-2-yl]amino]methyl]morpholine-4-carboxylate (PubChem CID 142541592) has the molecular formula C32H49N3O4 and a molecular weight of 539.76 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[[(3Z,5Z)-4-methoxy-2-methylhepta-1,3,5-trien-3-yl]-[(4Z)-3-methylidene-6-(2-methylpyrrolidin-1-yl)hepta-1,4,6-trien-2-yl]amino]methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[[(3Z,5Z)-4-methoxy-2-methylhepta-1,3,5-trien-3-yl]-[(4Z)-3-methylidene-6-(2-methylpyrrolidin-1-yl)hepta-1,4,6-trien-2-yl]amino]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 142541592 |
| Molecular Formula | C32H49N3O4 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.37 |
| IUPAC Name | tert-butyl (2R)-2-[[[(3Z,5Z)-4-methoxy-2-methylhepta-1,3,5-trien-3-yl]-[(4Z)-3-methylidene-6-(2-methylpyrrolidin-1-yl)hepta-1,4,6-trien-2-yl]amino]methyl]morpholine-4-carboxylate |
| SMILES | C=C(/C=C\C(=C)N1CCCC1C)C(=C)N(C[C@@H]1CN(C(=O)OC(C)(C)C)CCO1)/C(C(=C)C)=C(/C=C\C)OC |
| InChI | InChI=1S/C32H49N3O4/c1-12-14-29(37-11)30(23(2)3)35(22-28-21-33(19-20-38-28)31(36)39-32(8,9)10)27(7)24(4)16-17-26(6)34-18-13-15-25(34)5/h12,14,16-17,25,28H,2,4,6-7,13,15,18-22H2,1,3,5,8-11H3/b14-12-,17-16-,30-29-/t25?,28-/m0/s1 |
| InChIKey | SCVXXZYEEJLWOW-LDSRJUBTSA-N |
| XLogP | 6.56 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|