About (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine
(Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine (PubChem CID 142542138) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine.
Molecular Properties
| Compound Name | (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine |
| PubChem CID | 142542138 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine |
| SMILES | C=C/N=C(\C=C/C)N1CC2(CNC2)C1 |
| InChI | InChI=1S/C11H17N3/c1-3-5-10(13-4-2)14-8-11(9-14)6-12-7-11/h3-5,12H,2,6-9H2,1H3/b5-3-,13-10+ |
| InChIKey | ZQTZGVDFOLWLNI-MLJFPUFMSA-N |
| XLogP | 1.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine?
The IUPAC name of (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine (CID 142542138) is (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine.
What is the SMILES notation for (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine?
The canonical SMILES for (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine is C=C/N=C(\C=C/C)N1CC2(CNC2)C1.
What is the InChIKey of (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine?
The InChIKey is ZQTZGVDFOLWLNI-MLJFPUFMSA-N. The full InChI is InChI=1S/C11H17N3/c1-3-5-10(13-4-2)14-8-11(9-14)6-12-7-11/h3-5,12H,2,6-9H2,1H3/b5-3-,13-10+.
What are the key properties of (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine?
(Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine has a molecular weight of 191.28 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(2,6-diazaspiro[3.3]heptan-2-yl)-N-ethenylbut-2-en-1-imine is sourced from PubChem (CID 142542138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).