C18H24 — CID 142542320
2-ethenyl-1-[(1Z,3E)-2-ethyl-3-methylpenta-1,3-dienyl]-3,5-dimethylbenzene (PubChem CID 142542320) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-ethenyl-1-[(1Z,3E)-2-ethyl-3-methylpenta-1,3-dienyl]-3,5-dimethylbenzene.
| Compound Name | 2-ethenyl-1-[(1Z,3E)-2-ethyl-3-methylpenta-1,3-dienyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 142542320 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2-ethenyl-1-[(1Z,3E)-2-ethyl-3-methylpenta-1,3-dienyl]-3,5-dimethylbenzene |
| SMILES | C=Cc1c(C)cc(C)cc1/C=C(CC)\C(C)=C\C |
| InChI | InChI=1S/C18H24/c1-7-14(5)16(8-2)12-17-11-13(4)10-15(6)18(17)9-3/h7,9-12H,3,8H2,1-2,4-6H3/b14-7+,16-12- |
| InChIKey | YISPFZXJEWZEQG-QOCBPWLBSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|