About N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide
N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide (PubChem CID 142542959) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide.
Molecular Properties
| Compound Name | N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide |
| PubChem CID | 142542959 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide |
| SMILES | C=CN(/C(C)=N/C)c1cc(C)ncn1 |
| InChI | InChI=1S/C10H14N4/c1-5-14(9(3)11-4)10-6-8(2)12-7-13-10/h5-7H,1H2,2-4H3/b11-9+ |
| InChIKey | BHHCDHUZAGLROR-PKNBQFBNSA-N |
| XLogP | 1.78 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide?
The IUPAC name of N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide (CID 142542959) is N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide.
What is the SMILES notation for N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide?
The canonical SMILES for N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide is C=CN(/C(C)=N/C)c1cc(C)ncn1.
What is the InChIKey of N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide?
The InChIKey is BHHCDHUZAGLROR-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H14N4/c1-5-14(9(3)11-4)10-6-8(2)12-7-13-10/h5-7H,1H2,2-4H3/b11-9+.
What are the key properties of N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide?
N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide has a molecular weight of 190.25 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N'-methyl-N-(6-methylpyrimidin-4-yl)ethanimidamide is sourced from PubChem (CID 142542959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).