C17H34F3N — CID 142543512
ethane;(3R,5E)-1,1,1-trifluoro-3,5-dimethyl-N-propan-2-ylocta-5,7-dien-3-amine (PubChem CID 142543512) has the molecular formula C17H34F3N and a molecular weight of 309.46 g/mol. Its IUPAC name is ethane;(3R,5E)-1,1,1-trifluoro-3,5-dimethyl-N-propan-2-ylocta-5,7-dien-3-amine.
| Compound Name | ethane;(3R,5E)-1,1,1-trifluoro-3,5-dimethyl-N-propan-2-ylocta-5,7-dien-3-amine |
|---|---|
| PubChem CID | 142543512 |
| Molecular Formula | C17H34F3N |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.26 |
| IUPAC Name | ethane;(3R,5E)-1,1,1-trifluoro-3,5-dimethyl-N-propan-2-ylocta-5,7-dien-3-amine |
| SMILES | C=C/C=C(\C)C[C@](C)(CC(F)(F)F)NC(C)C.CC.CC |
| InChI | InChI=1S/C13H22F3N.2C2H6/c1-6-7-11(4)8-12(5,17-10(2)3)9-13(14,15)16;2*1-2/h6-7,10,17H,1,8-9H2,2-5H3;2*1-2H3/b11-7+;;/t12-;;/m1../s1 |
| InChIKey | XSOJRSBZXPYOSZ-YPAWVDPYSA-N |
| XLogP | 6.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|