C17H17N3OS2Si — CID 14254426
2-benzylsulfanyl-7-(2-trimethylsilylethynyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 14254426) has the molecular formula C17H17N3OS2Si and a molecular weight of 371.56 g/mol. Its IUPAC name is 2-benzylsulfanyl-7-(2-trimethylsilylethynyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-benzylsulfanyl-7-(2-trimethylsilylethynyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 14254426 |
| Molecular Formula | C17H17N3OS2Si |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-benzylsulfanyl-7-(2-trimethylsilylethynyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | C[Si](C)(C)C#Cc1cc(=O)n2nc(SCc3ccccc3)sc2n1 |
| InChI | InChI=1S/C17H17N3OS2Si/c1-24(2,3)10-9-14-11-15(21)20-16(18-14)23-17(19-20)22-12-13-7-5-4-6-8-13/h4-8,11H,12H2,1-3H3 |
| InChIKey | ZOTKRHVGBBBTAD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|