C20H22F3N3O2 — CID 142544375
2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]prop-2-enal (PubChem CID 142544375) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]prop-2-enal.
| Compound Name | 2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]prop-2-enal |
|---|---|
| PubChem CID | 142544375 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]prop-2-enal |
| SMILES | C=C(C=O)C1CCC(c2nnc(COc3cccc(C(F)(F)F)c3)n2C)CC1 |
| InChI | InChI=1S/C20H22F3N3O2/c1-13(11-27)14-6-8-15(9-7-14)19-25-24-18(26(19)2)12-28-17-5-3-4-16(10-17)20(21,22)23/h3-5,10-11,14-15H,1,6-9,12H2,2H3 |
| InChIKey | ZTSSQRCFOQLWIX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|