About tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate
tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate (PubChem CID 142544378) has the molecular formula C27H40N2O4Si
and a molecular weight of 484.71 g/mol. Its IUPAC name is tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate |
| PubChem CID | 142544378 |
| Molecular Formula | C27H40N2O4Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN[C@@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1 |
| InChI | InChI=1S/C27H40N2O4Si/c1-26(2,3)33-25(30)29-28-21-17-18-22(31-19-21)20-32-34(27(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,21-22,28H,17-20H2,1-6H3,(H,29,30)/t21-,22+/m1/s1 |
| InChIKey | SZDOZHLTROSTKG-YADHBBJMSA-N |
| XLogP | 4.14 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate?
The IUPAC name of tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate (CID 142544378) is tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate.
What is the SMILES notation for tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate?
The canonical SMILES for tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate is CC(C)(C)OC(=O)NN[C@@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1.
What is the InChIKey of tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate?
The InChIKey is SZDOZHLTROSTKG-YADHBBJMSA-N. The full InChI is InChI=1S/C27H40N2O4Si/c1-26(2,3)33-25(30)29-28-21-17-18-22(31-19-21)20-32-34(27(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,21-22,28H,17-20H2,1-6H3,(H,29,30)/t21-,22+/m1/s1.
What are the key properties of tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate?
tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate has a molecular weight of 484.71 g/mol, XLogP of 4.14, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]amino]carbamate is sourced from PubChem (CID 142544378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).