C20H22F3N3O3 — CID 142544436
2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]oxirane-2-carbaldehyde (PubChem CID 142544436) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is 2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]oxirane-2-carbaldehyde.
| Compound Name | 2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 142544436 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]oxirane-2-carbaldehyde |
| SMILES | Cn1c(COc2cccc(C(F)(F)F)c2)nnc1C1CCC(C2(C=O)CO2)CC1 |
| InChI | InChI=1S/C20H22F3N3O3/c1-26-17(10-28-16-4-2-3-15(9-16)20(21,22)23)24-25-18(26)13-5-7-14(8-6-13)19(11-27)12-29-19/h2-4,9,11,13-14H,5-8,10,12H2,1H3 |
| InChIKey | CAIGUZFIYAXWNE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|