C19H22F3N3O2 — CID 142544462
2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]acetaldehyde (PubChem CID 142544462) has the molecular formula C19H22F3N3O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is 2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]acetaldehyde.
| Compound Name | 2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 142544462 |
| Molecular Formula | C19H22F3N3O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexyl]acetaldehyde |
| SMILES | Cn1c(COc2cccc(C(F)(F)F)c2)nnc1C1CCC(CC=O)CC1 |
| InChI | InChI=1S/C19H22F3N3O2/c1-25-17(12-27-16-4-2-3-15(11-16)19(20,21)22)23-24-18(25)14-7-5-13(6-8-14)9-10-26/h2-4,10-11,13-14H,5-9,12H2,1H3 |
| InChIKey | VSKSIAZFBXBQMK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|