C14H9N3O3S2 — CID 14254448
2-benzylsulfonyl-7-ethynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 14254448) has the molecular formula C14H9N3O3S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-benzylsulfonyl-7-ethynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-benzylsulfonyl-7-ethynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 14254448 |
| Molecular Formula | C14H9N3O3S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 2-benzylsulfonyl-7-ethynyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | C#Cc1cc(=O)n2nc(S(=O)(=O)Cc3ccccc3)sc2n1 |
| InChI | InChI=1S/C14H9N3O3S2/c1-2-11-8-12(18)17-13(15-11)21-14(16-17)22(19,20)9-10-6-4-3-5-7-10/h1,3-8H,9H2 |
| InChIKey | AIILSHQCEAKYSU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|