C13H10ClN3O3S2 — CID 14254450
2-benzylsulfonyl-7-(chloromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 14254450) has the molecular formula C13H10ClN3O3S2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 2-benzylsulfonyl-7-(chloromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-benzylsulfonyl-7-(chloromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 14254450 |
| Molecular Formula | C13H10ClN3O3S2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 2-benzylsulfonyl-7-(chloromethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(CCl)nc2sc(S(=O)(=O)Cc3ccccc3)nn12 |
| InChI | InChI=1S/C13H10ClN3O3S2/c14-7-10-6-11(18)17-12(15-10)21-13(16-17)22(19,20)8-9-4-2-1-3-5-9/h1-6H,7-8H2 |
| InChIKey | CKUNJLKFEZCWRV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|