About 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane
5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane (PubChem CID 142544792) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane.
Molecular Properties
| Compound Name | 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane |
| PubChem CID | 142544792 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane |
| SMILES | CC.CC(C)C1=NC=CC(C)(C)C=N1 |
| InChI | InChI=1S/C10H16N2.C2H6/c1-8(2)9-11-6-5-10(3,4)7-12-9;1-2/h5-8H,1-4H3;1-2H3 |
| InChIKey | KVGSTHLUNOKKSM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane?
The IUPAC name of 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane (CID 142544792) is 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane.
What is the SMILES notation for 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane?
The canonical SMILES for 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane is CC.CC(C)C1=NC=CC(C)(C)C=N1.
What is the InChIKey of 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane?
The InChIKey is KVGSTHLUNOKKSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2.C2H6/c1-8(2)9-11-6-5-10(3,4)7-12-9;1-2/h5-8H,1-4H3;1-2H3.
What are the key properties of 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane?
5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane has a molecular weight of 194.32 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-propan-2-yl-1,3-diazepine;ethane is sourced from PubChem (CID 142544792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).