About benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone
benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone (PubChem CID 142544964) has the molecular formula C18H26N2O3
and a molecular weight of 318.42 g/mol. Its IUPAC name is benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone.
Molecular Properties
| Compound Name | benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone |
| PubChem CID | 142544964 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone |
| SMILES | O=C(C1CCCNC1)N1CCCC1.O=COCc1ccccc1 |
| InChI | InChI=1S/C10H18N2O.C8H8O2/c13-10(12-6-1-2-7-12)9-4-3-5-11-8-9;9-7-10-6-8-4-2-1-3-5-8/h9,11H,1-8H2;1-5,7H,6H2 |
| InChIKey | XGWIHYLCKOEEGQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone?
The IUPAC name of benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone (CID 142544964) is benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone.
What is the SMILES notation for benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone?
The canonical SMILES for benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone is O=C(C1CCCNC1)N1CCCC1.O=COCc1ccccc1.
What is the InChIKey of benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone?
The InChIKey is XGWIHYLCKOEEGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O.C8H8O2/c13-10(12-6-1-2-7-12)9-4-3-5-11-8-9;9-7-10-6-8-4-2-1-3-5-8/h9,11H,1-8H2;1-5,7H,6H2.
What are the key properties of benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone?
benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone has a molecular weight of 318.42 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl formate;piperidin-3-yl(pyrrolidin-1-yl)methanone is sourced from PubChem (CID 142544964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).