About thiadiazepane-4,5-diol
thiadiazepane-4,5-diol (PubChem CID 142545397) has the molecular formula C4H10N2O2S
and a molecular weight of 150.20 g/mol. Its IUPAC name is thiadiazepane-4,5-diol.
Molecular Properties
| Compound Name | thiadiazepane-4,5-diol |
| PubChem CID | 142545397 |
| Molecular Formula | C4H10N2O2S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | thiadiazepane-4,5-diol |
| SMILES | OC1CCSNNC1O |
| InChI | InChI=1S/C4H10N2O2S/c7-3-1-2-9-6-5-4(3)8/h3-8H,1-2H2 |
| InChIKey | PQXGALLBYLVNAJ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze thiadiazepane-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiadiazepane-4,5-diol?
The IUPAC name of thiadiazepane-4,5-diol (CID 142545397) is thiadiazepane-4,5-diol.
What is the SMILES notation for thiadiazepane-4,5-diol?
The canonical SMILES for thiadiazepane-4,5-diol is OC1CCSNNC1O.
What is the InChIKey of thiadiazepane-4,5-diol?
The InChIKey is PQXGALLBYLVNAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2S/c7-3-1-2-9-6-5-4(3)8/h3-8H,1-2H2.
What are the key properties of thiadiazepane-4,5-diol?
thiadiazepane-4,5-diol has a molecular weight of 150.20 g/mol, XLogP of -1.19, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiadiazepane-4,5-diol is sourced from PubChem (CID 142545397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).