C30H41NO5Si — CID 142545476
2-O-tert-butyl 3-O-ethyl (1S,3S,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 142545476) has the molecular formula C30H41NO5Si and a molecular weight of 523.75 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-ethyl (1S,3S,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-ethyl (1S,3S,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142545476 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 2-O-tert-butyl 3-O-ethyl (1S,3S,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C[C@@H](C[C@H]2O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H41NO5Si/c1-8-34-27(32)26-24-19-21(31(26)28(33)35-29(2,3)4)20-25(24)36-37(30(5,6)7,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,21,24-26H,8,19-20H2,1-7H3/t21-,24+,25+,26-/m0/s1 |
| InChIKey | SDFSMIXEHHVVRV-WSZJRCBQSA-N |
| XLogP | 4.89 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|