About 3,3-dimethylcyclohexan-1-amine;methyl formate
3,3-dimethylcyclohexan-1-amine;methyl formate (PubChem CID 142545986) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 3,3-dimethylcyclohexan-1-amine;methyl formate.
Molecular Properties
| Compound Name | 3,3-dimethylcyclohexan-1-amine;methyl formate |
| PubChem CID | 142545986 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 3,3-dimethylcyclohexan-1-amine;methyl formate |
| SMILES | CC1(C)CCCC(N)C1.COC=O |
| InChI | InChI=1S/C8H17N.C2H4O2/c1-8(2)5-3-4-7(9)6-8;1-4-2-3/h7H,3-6,9H2,1-2H3;2H,1H3 |
| InChIKey | WYXCNMNMVNBJAE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylcyclohexan-1-amine;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylcyclohexan-1-amine;methyl formate?
The IUPAC name of 3,3-dimethylcyclohexan-1-amine;methyl formate (CID 142545986) is 3,3-dimethylcyclohexan-1-amine;methyl formate.
What is the SMILES notation for 3,3-dimethylcyclohexan-1-amine;methyl formate?
The canonical SMILES for 3,3-dimethylcyclohexan-1-amine;methyl formate is CC1(C)CCCC(N)C1.COC=O.
What is the InChIKey of 3,3-dimethylcyclohexan-1-amine;methyl formate?
The InChIKey is WYXCNMNMVNBJAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C2H4O2/c1-8(2)5-3-4-7(9)6-8;1-4-2-3/h7H,3-6,9H2,1-2H3;2H,1H3.
What are the key properties of 3,3-dimethylcyclohexan-1-amine;methyl formate?
3,3-dimethylcyclohexan-1-amine;methyl formate has a molecular weight of 187.28 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylcyclohexan-1-amine;methyl formate is sourced from PubChem (CID 142545986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).