3,3-dimethylcyclohexan-1-amine;methyl formate

C10H21NO2 — CID 142545986

IUPAC3,3-dimethylcyclohexan-1-amine;methyl formate
SMILESCC1(C)CCCC(N)C1.COC=O
InChIInChI=1S/C8H17N.C2H4O2/c1-8(2)5-3-4-7(9)6-8;1-4-2-3/h7H,3-6,9H2,1-2H3;2H,1H3
InChIKeyWYXCNMNMVNBJAE-UHFFFAOYSA-N
MW187.28 g/mol
LogP1.70
Rot. Bonds1

About 3,3-dimethylcyclohexan-1-amine;methyl formate

3,3-dimethylcyclohexan-1-amine;methyl formate (PubChem CID 142545986) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 3,3-dimethylcyclohexan-1-amine;methyl formate.

Molecular Properties

Compound Name3,3-dimethylcyclohexan-1-amine;methyl formate
PubChem CID142545986
Molecular FormulaC10H21NO2
Molecular Weight187.28 g/mol
Exact Mass187.16
IUPAC Name3,3-dimethylcyclohexan-1-amine;methyl formate
SMILESCC1(C)CCCC(N)C1.COC=O
InChIInChI=1S/C8H17N.C2H4O2/c1-8(2)5-3-4-7(9)6-8;1-4-2-3/h7H,3-6,9H2,1-2H3;2H,1H3
InChIKeyWYXCNMNMVNBJAE-UHFFFAOYSA-N
XLogP1.70
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.28
LogP ≤ 51.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 3,3-dimethylcyclohexan-1-amine;methyl formate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethylcyclohexan-1-amine;methyl formate?
The IUPAC name of 3,3-dimethylcyclohexan-1-amine;methyl formate (CID 142545986) is 3,3-dimethylcyclohexan-1-amine;methyl formate.
What is the SMILES notation for 3,3-dimethylcyclohexan-1-amine;methyl formate?
The canonical SMILES for 3,3-dimethylcyclohexan-1-amine;methyl formate is CC1(C)CCCC(N)C1.COC=O.
What is the InChIKey of 3,3-dimethylcyclohexan-1-amine;methyl formate?
The InChIKey is WYXCNMNMVNBJAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C2H4O2/c1-8(2)5-3-4-7(9)6-8;1-4-2-3/h7H,3-6,9H2,1-2H3;2H,1H3.
What are the key properties of 3,3-dimethylcyclohexan-1-amine;methyl formate?
3,3-dimethylcyclohexan-1-amine;methyl formate has a molecular weight of 187.28 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylcyclohexan-1-amine;methyl formate is sourced from PubChem (CID 142545986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).