C26H32N4O2 — CID 142546095
3-(2-azaspiro[3.3]heptan-6-yl)-2-benzyl-6,7-dimethyl-8,9-dihydro-7H-imidazo[4,5-f]quinoline;formic acid (PubChem CID 142546095) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 3-(2-azaspiro[3.3]heptan-6-yl)-2-benzyl-6,7-dimethyl-8,9-dihydro-7H-imidazo[4,5-f]quinoline;formic acid.
| Compound Name | 3-(2-azaspiro[3.3]heptan-6-yl)-2-benzyl-6,7-dimethyl-8,9-dihydro-7H-imidazo[4,5-f]quinoline;formic acid |
|---|---|
| PubChem CID | 142546095 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 3-(2-azaspiro[3.3]heptan-6-yl)-2-benzyl-6,7-dimethyl-8,9-dihydro-7H-imidazo[4,5-f]quinoline;formic acid |
| SMILES | CC1CCc2c(ccc3c2nc(Cc2ccccc2)n3C2CC3(CNC3)C2)N1C.O=CO |
| InChI | InChI=1S/C25H30N4.CH2O2/c1-17-8-9-20-21(28(17)2)10-11-22-24(20)27-23(12-18-6-4-3-5-7-18)29(22)19-13-25(14-19)15-26-16-25;2-1-3/h3-7,10-11,17,19,26H,8-9,12-16H2,1-2H3;1H,(H,2,3) |
| InChIKey | GXPZIRNONKPHTC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|