C24H29N3O4 — CID 142546127
methyl 2-benzyl-3-(2,2-dimethoxyethyl)-7-methyl-8,9-dihydro-7H-imidazo[4,5-f]quinoline-6-carboxylate (PubChem CID 142546127) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is methyl 2-benzyl-3-(2,2-dimethoxyethyl)-7-methyl-8,9-dihydro-7H-imidazo[4,5-f]quinoline-6-carboxylate.
| Compound Name | methyl 2-benzyl-3-(2,2-dimethoxyethyl)-7-methyl-8,9-dihydro-7H-imidazo[4,5-f]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 142546127 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | methyl 2-benzyl-3-(2,2-dimethoxyethyl)-7-methyl-8,9-dihydro-7H-imidazo[4,5-f]quinoline-6-carboxylate |
| SMILES | COC(=O)N1c2ccc3c(nc(Cc4ccccc4)n3CC(OC)OC)c2CCC1C |
| InChI | InChI=1S/C24H29N3O4/c1-16-10-11-18-19(27(16)24(28)31-4)12-13-20-23(18)25-21(14-17-8-6-5-7-9-17)26(20)15-22(29-2)30-3/h5-9,12-13,16,22H,10-11,14-15H2,1-4H3 |
| InChIKey | ULWUIOKDRHLSAE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|