C30H41F2N3O5 — CID 142546266
3-[1-(5,5-difluorooxan-3-yl)-5-[methyl(pentan-2-yl)amino]benzimidazol-2-yl]-2-phenylpropanal;methanol;methyl formate (PubChem CID 142546266) has the molecular formula C30H41F2N3O5 and a molecular weight of 561.67 g/mol. Its IUPAC name is 3-[1-(5,5-difluorooxan-3-yl)-5-[methyl(pentan-2-yl)amino]benzimidazol-2-yl]-2-phenylpropanal;methanol;methyl formate.
| Compound Name | 3-[1-(5,5-difluorooxan-3-yl)-5-[methyl(pentan-2-yl)amino]benzimidazol-2-yl]-2-phenylpropanal;methanol;methyl formate |
|---|---|
| PubChem CID | 142546266 |
| Molecular Formula | C30H41F2N3O5 |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | 3-[1-(5,5-difluorooxan-3-yl)-5-[methyl(pentan-2-yl)amino]benzimidazol-2-yl]-2-phenylpropanal;methanol;methyl formate |
| SMILES | CCCC(C)N(C)c1ccc2c(c1)nc(CC(C=O)c1ccccc1)n2C1COCC(F)(F)C1.CO.COC=O |
| InChI | InChI=1S/C27H33F2N3O2.C2H4O2.CH4O/c1-4-8-19(2)31(3)22-11-12-25-24(14-22)30-26(13-21(16-33)20-9-6-5-7-10-20)32(25)23-15-27(28,29)18-34-17-23;1-4-2-3;1-2/h5-7,9-12,14,16,19,21,23H,4,8,13,15,17-18H2,1-3H3;2H,1H3;2H,1H3 |
| InChIKey | NUXLPQITSXLFRG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|