About 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane
6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane (PubChem CID 142546478) has the molecular formula C6H10FN3O
and a molecular weight of 159.16 g/mol. Its IUPAC name is 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane.
Molecular Properties
| Compound Name | 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane |
| PubChem CID | 142546478 |
| Molecular Formula | C6H10FN3O |
| Molecular Weight | 159.16 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane |
| SMILES | CF.Cc1cnc(=O)[nH]c1N |
| InChI | InChI=1S/C5H7N3O.CH3F/c1-3-2-7-5(9)8-4(3)6;1-2/h2H,1H3,(H3,6,7,8,9);1H3 |
| InChIKey | YALWEEZYQKEECY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.16 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane?
The IUPAC name of 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane (CID 142546478) is 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane.
What is the SMILES notation for 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane?
The canonical SMILES for 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane is CF.Cc1cnc(=O)[nH]c1N.
What is the InChIKey of 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane?
The InChIKey is YALWEEZYQKEECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O.CH3F/c1-3-2-7-5(9)8-4(3)6;1-2/h2H,1H3,(H3,6,7,8,9);1H3.
What are the key properties of 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane?
6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane has a molecular weight of 159.16 g/mol, XLogP of 0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-methyl-1H-pyrimidin-2-one;fluoromethane is sourced from PubChem (CID 142546478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).