About methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid
methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid (PubChem CID 14254648) has the molecular formula C19H21N2O7P
and a molecular weight of 420.36 g/mol. Its IUPAC name is methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid.
Molecular Properties
| Compound Name | methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid |
| PubChem CID | 14254648 |
| Molecular Formula | C19H21N2O7P |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid |
| SMILES | COC(=O)c1cccc2[nH]c(/C=C/c3ccc(OC)c(C)c3)nc12.O=P(O)(O)O |
| InChI | InChI=1S/C19H18N2O3.H3O4P/c1-12-11-13(7-9-16(12)23-2)8-10-17-20-15-6-4-5-14(18(15)21-17)19(22)24-3;1-5(2,3)4/h4-11H,1-3H3,(H,20,21);(H3,1,2,3,4)/b10-8+; |
| InChIKey | MCCUVCJHIAECFF-VRTOBVRTSA-N |
| XLogP | 2.91 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid?
The IUPAC name of methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid (CID 14254648) is methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid.
What is the SMILES notation for methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid?
The canonical SMILES for methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid is COC(=O)c1cccc2[nH]c(/C=C/c3ccc(OC)c(C)c3)nc12.O=P(O)(O)O.
What is the InChIKey of methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid?
The InChIKey is MCCUVCJHIAECFF-VRTOBVRTSA-N. The full InChI is InChI=1S/C19H18N2O3.H3O4P/c1-12-11-13(7-9-16(12)23-2)8-10-17-20-15-6-4-5-14(18(15)21-17)19(22)24-3;1-5(2,3)4/h4-11H,1-3H3,(H,20,21);(H3,1,2,3,4)/b10-8+;.
What are the key properties of methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid?
methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid has a molecular weight of 420.36 g/mol, XLogP of 2.91, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(E)-2-(4-methoxy-3-methylphenyl)ethenyl]-1H-benzimidazole-4-carboxylate;phosphoric acid is sourced from PubChem (CID 14254648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).