C19H21ClN6O — CID 142546985
4-(1-benzyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)-5-chloro-1H-pyridazin-6-one;ethanimine (PubChem CID 142546985) has the molecular formula C19H21ClN6O and a molecular weight of 384.87 g/mol. Its IUPAC name is 4-(1-benzyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)-5-chloro-1H-pyridazin-6-one;ethanimine.
| Compound Name | 4-(1-benzyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)-5-chloro-1H-pyridazin-6-one;ethanimine |
|---|---|
| PubChem CID | 142546985 |
| Molecular Formula | C19H21ClN6O |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-(1-benzyl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)-5-chloro-1H-pyridazin-6-one;ethanimine |
| SMILES | O=c1[nH]ncc(N2CCc3c(ncn3Cc3ccccc3)C2)c1Cl.[H]/N=C/C |
| InChI | InChI=1S/C17H16ClN5O.C2H5N/c18-16-15(8-20-21-17(16)24)22-7-6-14-13(10-22)19-11-23(14)9-12-4-2-1-3-5-12;1-2-3/h1-5,8,11H,6-7,9-10H2,(H,21,24);2-3H,1H3/b;3-2+ |
| InChIKey | UJJLOORXJRQHGI-ZPYUXNTASA-N |
| XLogP | 2.89 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|