C18H18F5NS — CID 142547273
ethane;(2E)-2-ethenyl-N-(2,3,4,5,6-pentafluorophenyl)sulfanyl-N-prop-2-ynylpenta-2,4-dien-1-amine (PubChem CID 142547273) has the molecular formula C18H18F5NS and a molecular weight of 375.41 g/mol. Its IUPAC name is ethane;(2E)-2-ethenyl-N-(2,3,4,5,6-pentafluorophenyl)sulfanyl-N-prop-2-ynylpenta-2,4-dien-1-amine.
| Compound Name | ethane;(2E)-2-ethenyl-N-(2,3,4,5,6-pentafluorophenyl)sulfanyl-N-prop-2-ynylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142547273 |
| Molecular Formula | C18H18F5NS |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethane;(2E)-2-ethenyl-N-(2,3,4,5,6-pentafluorophenyl)sulfanyl-N-prop-2-ynylpenta-2,4-dien-1-amine |
| SMILES | C#CCN(C/C(C=C)=C/C=C)Sc1c(F)c(F)c(F)c(F)c1F.CC |
| InChI | InChI=1S/C16H12F5NS.C2H6/c1-4-7-10(6-3)9-22(8-5-2)23-16-14(20)12(18)11(17)13(19)15(16)21;1-2/h2,4,6-7H,1,3,8-9H2;1-2H3/b10-7+; |
| InChIKey | URGIQQPZLPNZJH-HCUGZAAXSA-N |
| XLogP | 5.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|