C33H36N3O+ — CID 142547319
1-methoxy-3-N,3-N,6-N,6-N-tetramethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-3,6-diamine (PubChem CID 142547319) has the molecular formula C33H36N3O+ and a molecular weight of 490.67 g/mol. Its IUPAC name is 1-methoxy-3-N,3-N,6-N,6-N-tetramethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-3,6-diamine.
| Compound Name | 1-methoxy-3-N,3-N,6-N,6-N-tetramethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-3,6-diamine |
|---|---|
| PubChem CID | 142547319 |
| Molecular Formula | C33H36N3O+ |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 1-methoxy-3-N,3-N,6-N,6-N-tetramethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-3,6-diamine |
| SMILES | COc1cc(N(C)C)cc2c1c(-c1c(C)cc(C)cc1C)c1ccc(N(C)C)cc1[n+]2-c1ccccc1 |
| InChI | InChI=1S/C33H36N3O/c1-21-16-22(2)31(23(3)17-21)32-27-15-14-25(34(4)5)18-28(27)36(24-12-10-9-11-13-24)29-19-26(35(6)7)20-30(37-8)33(29)32/h9-20H,1-8H3/q+1 |
| InChIKey | LNONHWFRLQJZDO-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 19.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|