C31H31BrN2O — CID 142547329
8-methoxy-N,N-dimethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-2-amine bromide (PubChem CID 142547329) has the molecular formula C31H31BrN2O and a molecular weight of 527.51 g/mol. Its IUPAC name is 8-methoxy-N,N-dimethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-2-amine bromide.
| Compound Name | 8-methoxy-N,N-dimethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-2-amine bromide |
|---|---|
| PubChem CID | 142547329 |
| Molecular Formula | C31H31BrN2O |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 8-methoxy-N,N-dimethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-2-amine bromide |
| SMILES | COc1cccc2c1c(-c1c(C)cc(C)cc1C)c1cc(N(C)C)ccc1[n+]2-c1ccccc1.[Br-] |
| InChI | InChI=1S/C31H31N2O.BrH/c1-20-17-21(2)29(22(3)18-20)30-25-19-24(32(4)5)15-16-26(25)33(23-11-8-7-9-12-23)27-13-10-14-28(34-6)31(27)30;/h7-19H,1-6H3;1H/q+1;/p-1 |
| InChIKey | ARPXVGRJCLTNBQ-UHFFFAOYSA-M |
| XLogP | 3.94 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|