C24H34N6O2Si — CID 142547769
N,N-dimethyl-2-[[4-pyrazolo[1,5-b]pyridazin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]methoxy]ethanamine (PubChem CID 142547769) has the molecular formula C24H34N6O2Si and a molecular weight of 466.66 g/mol. Its IUPAC name is N,N-dimethyl-2-[[4-pyrazolo[1,5-b]pyridazin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]methoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[[4-pyrazolo[1,5-b]pyridazin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]methoxy]ethanamine |
|---|---|
| PubChem CID | 142547769 |
| Molecular Formula | C24H34N6O2Si |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | N,N-dimethyl-2-[[4-pyrazolo[1,5-b]pyridazin-3-yl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]methoxy]ethanamine |
| SMILES | CN(C)CCOCc1cc2c(-c3cnn4ncccc34)ccnc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H34N6O2Si/c1-28(2)11-12-31-17-19-15-21-20(22-16-27-30-23(22)7-6-9-26-30)8-10-25-24(21)29(19)18-32-13-14-33(3,4)5/h6-10,15-16H,11-14,17-18H2,1-5H3 |
| InChIKey | BPGRCIZPBOQCHU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|