C22H24N8O — CID 142547807
piperidine-1-carbonitrile;N-[2-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]formamide (PubChem CID 142547807) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is piperidine-1-carbonitrile;N-[2-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]formamide.
| Compound Name | piperidine-1-carbonitrile;N-[2-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]formamide |
|---|---|
| PubChem CID | 142547807 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | piperidine-1-carbonitrile;N-[2-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]formamide |
| SMILES | N#CN1CCCCC1.O=CNCCc1cc2c(-c3cnn4ncccc34)ccnc2[nH]1 |
| InChI | InChI=1S/C16H14N6O.C6H10N2/c23-10-17-6-3-11-8-13-12(4-7-18-16(13)21-11)14-9-20-22-15(14)2-1-5-19-22;7-6-8-4-2-1-3-5-8/h1-2,4-5,7-10H,3,6H2,(H,17,23)(H,18,21);1-5H2 |
| InChIKey | PQCADQXHJIUQGP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|