C32H37N7O5S — CID 142547818
N-[2-[1-(benzenesulfonyl)-4-pyrazolo[1,5-b]pyridazin-3-ylpyrrolo[2,3-b]pyridin-2-yl]ethyl]formamide;tert-butyl piperidine-1-carboxylate (PubChem CID 142547818) has the molecular formula C32H37N7O5S and a molecular weight of 631.76 g/mol. Its IUPAC name is N-[2-[1-(benzenesulfonyl)-4-pyrazolo[1,5-b]pyridazin-3-ylpyrrolo[2,3-b]pyridin-2-yl]ethyl]formamide;tert-butyl piperidine-1-carboxylate.
| Compound Name | N-[2-[1-(benzenesulfonyl)-4-pyrazolo[1,5-b]pyridazin-3-ylpyrrolo[2,3-b]pyridin-2-yl]ethyl]formamide;tert-butyl piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142547818 |
| Molecular Formula | C32H37N7O5S |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | N-[2-[1-(benzenesulfonyl)-4-pyrazolo[1,5-b]pyridazin-3-ylpyrrolo[2,3-b]pyridin-2-yl]ethyl]formamide;tert-butyl piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.O=CNCCc1cc2c(-c3cnn4ncccc34)ccnc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18N6O3S.C10H19NO2/c29-15-23-11-8-16-13-19-18(20-14-26-28-21(20)7-4-10-25-28)9-12-24-22(19)27(16)32(30,31)17-5-2-1-3-6-17;1-10(2,3)13-9(12)11-7-5-4-6-8-11/h1-7,9-10,12-15H,8,11H2,(H,23,29);4-8H2,1-3H3 |
| InChIKey | BGBUFSZZTYQGAT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|